About (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine
(5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine (PubChem CID 172608407) has the molecular formula C11H15ClFN3O
and a molecular weight of 259.71 g/mol. Its IUPAC name is (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine.
Molecular Properties
| Compound Name | (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine |
| PubChem CID | 172608407 |
| Molecular Formula | C11H15ClFN3O |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine |
| SMILES | C[C@@H]1COC(C)(C)CN1c1nc(Cl)ncc1F |
| InChI | InChI=1S/C11H15ClFN3O/c1-7-5-17-11(2,3)6-16(7)9-8(13)4-14-10(12)15-9/h4,7H,5-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | IPFPMVMBMSMWLU-SSDOTTSWSA-N |
| XLogP | 2.27 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine?
The IUPAC name of (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine (CID 172608407) is (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine.
What is the SMILES notation for (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine?
The canonical SMILES for (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine is C[C@@H]1COC(C)(C)CN1c1nc(Cl)ncc1F.
What is the InChIKey of (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine?
The InChIKey is IPFPMVMBMSMWLU-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H15ClFN3O/c1-7-5-17-11(2,3)6-16(7)9-8(13)4-14-10(12)15-9/h4,7H,5-6H2,1-3H3/t7-/m1/s1.
What are the key properties of (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine?
(5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine has a molecular weight of 259.71 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2,5-trimethylmorpholine is sourced from PubChem (CID 172608407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).