About 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine
4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine (PubChem CID 172608412) has the molecular formula C12H17ClFN3O
and a molecular weight of 273.74 g/mol. Its IUPAC name is 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine.
Molecular Properties
| Compound Name | 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine |
| PubChem CID | 172608412 |
| Molecular Formula | C12H17ClFN3O |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine |
| SMILES | CCC1(CC)CN(c2nc(Cl)ncc2F)CCO1 |
| InChI | InChI=1S/C12H17ClFN3O/c1-3-12(4-2)8-17(5-6-18-12)10-9(14)7-15-11(13)16-10/h7H,3-6,8H2,1-2H3 |
| InChIKey | ICBIBRYYLULWQX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine?
The IUPAC name of 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine (CID 172608412) is 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine.
What is the SMILES notation for 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine?
The canonical SMILES for 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine is CCC1(CC)CN(c2nc(Cl)ncc2F)CCO1.
What is the InChIKey of 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine?
The InChIKey is ICBIBRYYLULWQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClFN3O/c1-3-12(4-2)8-17(5-6-18-12)10-9(14)7-15-11(13)16-10/h7H,3-6,8H2,1-2H3.
What are the key properties of 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine?
4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine has a molecular weight of 273.74 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-5-fluoropyrimidin-4-yl)-2,2-diethylmorpholine is sourced from PubChem (CID 172608412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).