C29H37FN8O — CID 172608646
3-[4-[2-[amino-[(Z)-1-aminoprop-1-en-2-yl]amino]-4-fluorophenyl]-6-cyclopropyl-2-pyridinyl]-6-(propylaminomethyl)-5H-pyrrolo[3,2-d]pyrimidin-4-one;ethane (PubChem CID 172608646) has the molecular formula C29H37FN8O and a molecular weight of 532.67 g/mol. Its IUPAC name is 3-[4-[2-[amino-[(Z)-1-aminoprop-1-en-2-yl]amino]-4-fluorophenyl]-6-cyclopropyl-2-pyridinyl]-6-(propylaminomethyl)-5H-pyrrolo[3,2-d]pyrimidin-4-one;ethane.
| Compound Name | 3-[4-[2-[amino-[(Z)-1-aminoprop-1-en-2-yl]amino]-4-fluorophenyl]-6-cyclopropyl-2-pyridinyl]-6-(propylaminomethyl)-5H-pyrrolo[3,2-d]pyrimidin-4-one;ethane |
|---|---|
| PubChem CID | 172608646 |
| Molecular Formula | C29H37FN8O |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 3-[4-[2-[amino-[(Z)-1-aminoprop-1-en-2-yl]amino]-4-fluorophenyl]-6-cyclopropyl-2-pyridinyl]-6-(propylaminomethyl)-5H-pyrrolo[3,2-d]pyrimidin-4-one;ethane |
| SMILES | CC.CCCNCc1cc2ncn(-c3cc(-c4ccc(F)cc4N(N)/C(C)=C\N)cc(C4CC4)n3)c(=O)c2[nH]1 |
| InChI | InChI=1S/C27H31FN8O.C2H6/c1-3-8-31-14-20-12-23-26(33-20)27(37)35(15-32-23)25-10-18(9-22(34-25)17-4-5-17)21-7-6-19(28)11-24(21)36(30)16(2)13-29;1-2/h6-7,9-13,15,17,31,33H,3-5,8,14,29-30H2,1-2H3;1-2H3/b16-13-; |
| InChIKey | JGTDNEIFDNNYOY-UNVLYCKESA-N |
| XLogP | 4.82 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|