C26H31NO4S — CID 172609062
tert-butyl 2-(3-tert-butylphenyl)-5-(2-methoxy-2-oxoethyl)sulfanylindole-1-carboxylate (PubChem CID 172609062) has the molecular formula C26H31NO4S and a molecular weight of 453.60 g/mol. Its IUPAC name is tert-butyl 2-(3-tert-butylphenyl)-5-(2-methoxy-2-oxoethyl)sulfanylindole-1-carboxylate.
| Compound Name | tert-butyl 2-(3-tert-butylphenyl)-5-(2-methoxy-2-oxoethyl)sulfanylindole-1-carboxylate |
|---|---|
| PubChem CID | 172609062 |
| Molecular Formula | C26H31NO4S |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | tert-butyl 2-(3-tert-butylphenyl)-5-(2-methoxy-2-oxoethyl)sulfanylindole-1-carboxylate |
| SMILES | COC(=O)CSc1ccc2c(c1)cc(-c1cccc(C(C)(C)C)c1)n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H31NO4S/c1-25(2,3)19-10-8-9-17(13-19)22-15-18-14-20(32-16-23(28)30-7)11-12-21(18)27(22)24(29)31-26(4,5)6/h8-15H,16H2,1-7H3 |
| InChIKey | FXVSFRHCLQZFGU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |