About tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate
tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate (PubChem CID 172609420) has the molecular formula C22H26N2O4S
and a molecular weight of 414.53 g/mol. Its IUPAC name is tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate |
| PubChem CID | 172609420 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)Cc1cc2ccn(S(=O)(=O)c3ccccc3)c2cn1 |
| InChI | InChI=1S/C22H26N2O4S/c1-21(2,3)28-20(25)22(4,5)14-17-13-16-11-12-24(19(16)15-23-17)29(26,27)18-9-7-6-8-10-18/h6-13,15H,14H2,1-5H3 |
| InChIKey | KPLPQCWCUNCDHY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate?
The IUPAC name of tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate (CID 172609420) is tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate.
What is the SMILES notation for tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate?
The canonical SMILES for tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate is CC(C)(C)OC(=O)C(C)(C)Cc1cc2ccn(S(=O)(=O)c3ccccc3)c2cn1.
What is the InChIKey of tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate?
The InChIKey is KPLPQCWCUNCDHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O4S/c1-21(2,3)28-20(25)22(4,5)14-17-13-16-11-12-24(19(16)15-23-17)29(26,27)18-9-7-6-8-10-18/h6-13,15H,14H2,1-5H3.
What are the key properties of tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate?
tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate has a molecular weight of 414.53 g/mol, XLogP of 4.18, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[1-(benzenesulfonyl)pyrrolo[2,3-c]pyridin-5-yl]-2,2-dimethylpropanoate is sourced from PubChem (CID 172609420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).