C16H22ClFN4O3 — CID 172609759
6-(2,6-dioxopiperidin-3-yl)-6-fluoro-4-piperazin-1-ylcyclohexa-2,4-diene-1-carboxamide;hydrochloride (PubChem CID 172609759) has the molecular formula C16H22ClFN4O3 and a molecular weight of 372.83 g/mol. Its IUPAC name is 6-(2,6-dioxopiperidin-3-yl)-6-fluoro-4-piperazin-1-ylcyclohexa-2,4-diene-1-carboxamide;hydrochloride.
| Compound Name | 6-(2,6-dioxopiperidin-3-yl)-6-fluoro-4-piperazin-1-ylcyclohexa-2,4-diene-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172609759 |
| Molecular Formula | C16H22ClFN4O3 |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 6-(2,6-dioxopiperidin-3-yl)-6-fluoro-4-piperazin-1-ylcyclohexa-2,4-diene-1-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1C=CC(N2CCNCC2)=CC1(F)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H21FN4O3.ClH/c17-16(12-3-4-13(22)20-15(12)24)9-10(1-2-11(16)14(18)23)21-7-5-19-6-8-21;/h1-2,9,11-12,19H,3-8H2,(H2,18,23)(H,20,22,24);1H |
| InChIKey | HPTAEIVKIHLKHP-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|