C20H18F3N3O2 — CID 172610211
5-cyclobutyl-3-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]iminopyrrolo[3,4-c]pyridine-1,6-dione (PubChem CID 172610211) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 5-cyclobutyl-3-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]iminopyrrolo[3,4-c]pyridine-1,6-dione.
| Compound Name | 5-cyclobutyl-3-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]iminopyrrolo[3,4-c]pyridine-1,6-dione |
|---|---|
| PubChem CID | 172610211 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 5-cyclobutyl-3-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]iminopyrrolo[3,4-c]pyridine-1,6-dione |
| SMILES | C[C@@H](/N=C1\NC(=O)c2cc(=O)n(C3CCC3)cc21)c1cccc(C(F)F)c1F |
| InChI | InChI=1S/C20H18F3N3O2/c1-10(12-6-3-7-13(17(12)21)18(22)23)24-19-15-9-26(11-4-2-5-11)16(27)8-14(15)20(28)25-19/h3,6-11,18H,2,4-5H2,1H3,(H,24,25,28)/t10-/m1/s1 |
| InChIKey | VBQUWHMBFHGCMZ-SNVBAGLBSA-N |
| XLogP | 3.90 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|