C23H23Cl2N5O3 — CID 172611198
1-[6-[[4-(2,3-dichloro-4-pyridinyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]-1,3-diazinane-2,4-dione (PubChem CID 172611198) has the molecular formula C23H23Cl2N5O3 and a molecular weight of 488.38 g/mol. Its IUPAC name is 1-[6-[[4-(2,3-dichloro-4-pyridinyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[6-[[4-(2,3-dichloro-4-pyridinyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 172611198 |
| Molecular Formula | C23H23Cl2N5O3 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 1-[6-[[4-(2,3-dichloro-4-pyridinyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(N2Cc3cc(CN4CCC(c5ccnc(Cl)c5Cl)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H23Cl2N5O3/c24-20-17(3-7-26-21(20)25)15-4-8-28(9-5-15)12-14-1-2-18-16(11-14)13-30(22(18)32)29-10-6-19(31)27-23(29)33/h1-3,7,11,15H,4-6,8-10,12-13H2,(H,27,31,33) |
| InChIKey | KNUWXSLQDTVYJR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|