About 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one
1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one (PubChem CID 172611720) has the molecular formula C16H27N3O4
and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one.
Molecular Properties
| Compound Name | 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one |
| PubChem CID | 172611720 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one |
| SMILES | CC(C)CC1NCCN(CC(=O)N2CCC3(CC2)COO3)C1=O |
| InChI | InChI=1S/C16H27N3O4/c1-12(2)9-13-15(21)19(8-5-17-13)10-14(20)18-6-3-16(4-7-18)11-22-23-16/h12-13,17H,3-11H2,1-2H3 |
| InChIKey | LCTIGFGFLZTEAA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one?
The IUPAC name of 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one (CID 172611720) is 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one.
What is the SMILES notation for 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one?
The canonical SMILES for 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one is CC(C)CC1NCCN(CC(=O)N2CCC3(CC2)COO3)C1=O.
What is the InChIKey of 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one?
The InChIKey is LCTIGFGFLZTEAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O4/c1-12(2)9-13-15(21)19(8-5-17-13)10-14(20)18-6-3-16(4-7-18)11-22-23-16/h12-13,17H,3-11H2,1-2H3.
What are the key properties of 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one?
1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one has a molecular weight of 325.41 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,2-dioxa-7-azaspiro[3.5]nonan-7-yl)-2-oxoethyl]-3-(2-methylpropyl)piperazin-2-one is sourced from PubChem (CID 172611720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).