C9H4Cl2F3N3O — CID 172611990
6,8-dichloro-3-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidin-4-one (PubChem CID 172611990) has the molecular formula C9H4Cl2F3N3O and a molecular weight of 298.05 g/mol. Its IUPAC name is 6,8-dichloro-3-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 6,8-dichloro-3-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 172611990 |
| Molecular Formula | C9H4Cl2F3N3O |
| Molecular Weight | 298.05 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 6,8-dichloro-3-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cc(Cl)nc(Cl)c2ncn1CC(F)(F)F |
| InChI | InChI=1S/C9H4Cl2F3N3O/c10-5-1-4-6(7(11)16-5)15-3-17(8(4)18)2-9(12,13)14/h1,3H,2H2 |
| InChIKey | JYLVVNYKTPREQA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.05 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|