About 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide
2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide (PubChem CID 172612156) has the molecular formula C8H6ClF3N4O2
and a molecular weight of 282.61 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide |
| PubChem CID | 172612156 |
| Molecular Formula | C8H6ClF3N4O2 |
| Molecular Weight | 282.61 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide |
| SMILES | CNC(=O)c1nc(Cl)ncc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H6ClF3N4O2/c1-13-5(17)4-3(2-14-7(9)16-4)15-6(18)8(10,11)12/h2H,1H3,(H,13,17)(H,15,18) |
| InChIKey | BXFUAFBMIBXCND-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.61 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide?
The IUPAC name of 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide (CID 172612156) is 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide.
What is the SMILES notation for 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide?
The canonical SMILES for 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide is CNC(=O)c1nc(Cl)ncc1NC(=O)C(F)(F)F.
What is the InChIKey of 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide?
The InChIKey is BXFUAFBMIBXCND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF3N4O2/c1-13-5(17)4-3(2-14-7(9)16-4)15-6(18)8(10,11)12/h2H,1H3,(H,13,17)(H,15,18).
What are the key properties of 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide?
2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide has a molecular weight of 282.61 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methyl-5-[(2,2,2-trifluoroacetyl)amino]pyrimidine-4-carboxamide is sourced from PubChem (CID 172612156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).