About 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide
2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide (PubChem CID 172612164) has the molecular formula C8H7ClF2N4O2
and a molecular weight of 264.62 g/mol. Its IUPAC name is 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide |
| PubChem CID | 172612164 |
| Molecular Formula | C8H7ClF2N4O2 |
| Molecular Weight | 264.62 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide |
| SMILES | CNC(=O)c1nc(Cl)ncc1NC(=O)C(F)F |
| InChI | InChI=1S/C8H7ClF2N4O2/c1-12-6(16)4-3(2-13-8(9)15-4)14-7(17)5(10)11/h2,5H,1H3,(H,12,16)(H,14,17) |
| InChIKey | KGEFLCMSANSAEI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.62 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide?
The IUPAC name of 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide (CID 172612164) is 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide.
What is the SMILES notation for 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide?
The canonical SMILES for 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide is CNC(=O)c1nc(Cl)ncc1NC(=O)C(F)F.
What is the InChIKey of 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide?
The InChIKey is KGEFLCMSANSAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF2N4O2/c1-12-6(16)4-3(2-13-8(9)15-4)14-7(17)5(10)11/h2,5H,1H3,(H,12,16)(H,14,17).
What are the key properties of 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide?
2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide has a molecular weight of 264.62 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(2,2-difluoroacetyl)amino]-N-methylpyrimidine-4-carboxamide is sourced from PubChem (CID 172612164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).