About CID 172612511
CID 172612511 (PubChem CID 172612511) has the molecular formula C11H20I-
and a molecular weight of 279.18 g/mol.
Molecular Properties
| Compound Name | CID 172612511 |
| PubChem CID | 172612511 |
| Molecular Formula | C11H20I- |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | — |
| SMILES | CC1CCCCC2(CCCC2)[I-]1 |
| InChI | InChI=1S/C11H20I/c1-10-6-2-3-7-11(12-10)8-4-5-9-11/h10H,2-9H2,1H3/q-1 |
| InChIKey | XNNMXBKQVUUNJH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 172612511 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172612511?
The IUPAC name of CID 172612511 (CID 172612511) is not available.
What is the SMILES notation for CID 172612511?
The canonical SMILES for CID 172612511 is CC1CCCCC2(CCCC2)[I-]1.
What is the InChIKey of CID 172612511?
The InChIKey is XNNMXBKQVUUNJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20I/c1-10-6-2-3-7-11(12-10)8-4-5-9-11/h10H,2-9H2,1H3/q-1.
What are the key properties of CID 172612511?
CID 172612511 has a molecular weight of 279.18 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172612511 is sourced from PubChem (CID 172612511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).