About 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane
10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane (PubChem CID 172612559) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane |
| PubChem CID | 172612559 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane |
| SMILES | C=C(C)C1CCOC2(CCOC2)C1C |
| InChI | InChI=1S/C12H20O2/c1-9(2)11-4-6-14-12(10(11)3)5-7-13-8-12/h10-11H,1,4-8H2,2-3H3 |
| InChIKey | FFTHWPZPIVSJIP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane?
The IUPAC name of 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane (CID 172612559) is 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane.
What is the SMILES notation for 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane?
The canonical SMILES for 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane is C=C(C)C1CCOC2(CCOC2)C1C.
What is the InChIKey of 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane?
The InChIKey is FFTHWPZPIVSJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-9(2)11-4-6-14-12(10(11)3)5-7-13-8-12/h10-11H,1,4-8H2,2-3H3.
What are the key properties of 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane?
10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane has a molecular weight of 196.29 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-9-prop-1-en-2-yl-2,6-dioxaspiro[4.5]decane is sourced from PubChem (CID 172612559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).