About cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol
cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol (PubChem CID 172612633) has the molecular formula C10H18Ce2O6
and a molecular weight of 514.48 g/mol. Its IUPAC name is cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol.
Molecular Properties
| Compound Name | cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol |
| PubChem CID | 172612633 |
| Molecular Formula | C10H18Ce2O6 |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 513.92 |
| IUPAC Name | cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol |
| SMILES | CO.O=CC1(COCCC(=O)O)CCOC1.[Ce].[Ce] |
| InChI | InChI=1S/C9H14O5.CH4O.2Ce/c10-5-9(2-4-14-7-9)6-13-3-1-8(11)12;1-2;;/h5H,1-4,6-7H2,(H,11,12);2H,1H3;; |
| InChIKey | ONWHJYYCYULNQP-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol?
The IUPAC name of cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol (CID 172612633) is cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol.
What is the SMILES notation for cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol?
The canonical SMILES for cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol is CO.O=CC1(COCCC(=O)O)CCOC1.[Ce].[Ce].
What is the InChIKey of cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol?
The InChIKey is ONWHJYYCYULNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5.CH4O.2Ce/c10-5-9(2-4-14-7-9)6-13-3-1-8(11)12;1-2;;/h5H,1-4,6-7H2,(H,11,12);2H,1H3;;.
What are the key properties of cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol?
cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol has a molecular weight of 514.48 g/mol, XLogP of -0.31, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;3-[(3-formyloxolan-3-yl)methoxy]propanoic acid;methanol is sourced from PubChem (CID 172612633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).