C26H35FN6O3 — CID 172612858
(4Z,6R)-4-[amino-[4-[(Z)-1-amino-3-methyliminoprop-1-enyl]-6-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 172612858) has the molecular formula C26H35FN6O3 and a molecular weight of 498.60 g/mol. Its IUPAC name is (4Z,6R)-4-[amino-[4-[(Z)-1-amino-3-methyliminoprop-1-enyl]-6-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (4Z,6R)-4-[amino-[4-[(Z)-1-amino-3-methyliminoprop-1-enyl]-6-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 172612858 |
| Molecular Formula | C26H35FN6O3 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | (4Z,6R)-4-[amino-[4-[(Z)-1-amino-3-methyliminoprop-1-enyl]-6-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | C/N=C/C=C(\N)c1cc(OC[C@@H]2C[C@H](F)CN2C)nc(/C(N)=C2\CCC[C@@]3(CCCCC3=O)C2=O)n1 |
| InChI | InChI=1S/C26H35FN6O3/c1-30-11-8-19(28)20-13-22(36-15-17-12-16(27)14-33(17)2)32-25(31-20)23(29)18-6-5-10-26(24(18)35)9-4-3-7-21(26)34/h8,11,13,16-17H,3-7,9-10,12,14-15,28-29H2,1-2H3/b19-8-,23-18-,30-11+/t16-,17-,26+/m0/s1 |
| InChIKey | UZRKLNGJIKTITP-WZVYRSQYSA-N |
| XLogP | 2.45 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|