About ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate
ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate (PubChem CID 172613288) has the molecular formula C15H18ClF2NO5S
and a molecular weight of 397.83 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate |
| PubChem CID | 172613288 |
| Molecular Formula | C15H18ClF2NO5S |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate |
| SMILES | CCOC(=O)C1(Cc2cc(Cl)c(F)cc2F)CC(NS(C)(=O)=O)CO1 |
| InChI | InChI=1S/C15H18ClF2NO5S/c1-3-23-14(20)15(7-10(8-24-15)19-25(2,21)22)6-9-4-11(16)13(18)5-12(9)17/h4-5,10,19H,3,6-8H2,1-2H3 |
| InChIKey | DCNWQUYIBBQDRF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate?
The IUPAC name of ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate (CID 172613288) is ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate.
What is the SMILES notation for ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate?
The canonical SMILES for ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate is CCOC(=O)C1(Cc2cc(Cl)c(F)cc2F)CC(NS(C)(=O)=O)CO1.
What is the InChIKey of ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate?
The InChIKey is DCNWQUYIBBQDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClF2NO5S/c1-3-23-14(20)15(7-10(8-24-15)19-25(2,21)22)6-9-4-11(16)13(18)5-12(9)17/h4-5,10,19H,3,6-8H2,1-2H3.
What are the key properties of ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate?
ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate has a molecular weight of 397.83 g/mol, XLogP of 1.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(5-chloro-2,4-difluorophenyl)methyl]-4-(methanesulfonamido)oxolane-2-carboxylate is sourced from PubChem (CID 172613288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).