C23H25F3N2O2S — CID 172613301
2-cyclopentyl-4-[[2-(2,6-difluoro-3-methylphenyl)-6-fluorophenoxy]methyl]-1,3-oxazole;S-methylthiohydroxylamine (PubChem CID 172613301) has the molecular formula C23H25F3N2O2S and a molecular weight of 450.53 g/mol. Its IUPAC name is 2-cyclopentyl-4-[[2-(2,6-difluoro-3-methylphenyl)-6-fluorophenoxy]methyl]-1,3-oxazole;S-methylthiohydroxylamine.
| Compound Name | 2-cyclopentyl-4-[[2-(2,6-difluoro-3-methylphenyl)-6-fluorophenoxy]methyl]-1,3-oxazole;S-methylthiohydroxylamine |
|---|---|
| PubChem CID | 172613301 |
| Molecular Formula | C23H25F3N2O2S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-cyclopentyl-4-[[2-(2,6-difluoro-3-methylphenyl)-6-fluorophenoxy]methyl]-1,3-oxazole;S-methylthiohydroxylamine |
| SMILES | CSN.Cc1ccc(F)c(-c2cccc(F)c2OCc2coc(C3CCCC3)n2)c1F |
| InChI | InChI=1S/C22H20F3NO2.CH5NS/c1-13-9-10-17(23)19(20(13)25)16-7-4-8-18(24)21(16)27-11-15-12-28-22(26-15)14-5-2-3-6-14;1-3-2/h4,7-10,12,14H,2-3,5-6,11H2,1H3;2H2,1H3 |
| InChIKey | APVOSEMMNANCEQ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|