C26H24N2O4 — CID 172613814
N-benzyl-N-[2-(2,4-dihydroxy-5-methylbenzoyl)-1,3-dihydroisoindol-4-yl]prop-2-enamide (PubChem CID 172613814) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-benzyl-N-[2-(2,4-dihydroxy-5-methylbenzoyl)-1,3-dihydroisoindol-4-yl]prop-2-enamide.
| Compound Name | N-benzyl-N-[2-(2,4-dihydroxy-5-methylbenzoyl)-1,3-dihydroisoindol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 172613814 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-benzyl-N-[2-(2,4-dihydroxy-5-methylbenzoyl)-1,3-dihydroisoindol-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1ccccc1)c1cccc2c1CN(C(=O)c1cc(C)c(O)cc1O)C2 |
| InChI | InChI=1S/C26H24N2O4/c1-3-25(31)28(14-18-8-5-4-6-9-18)22-11-7-10-19-15-27(16-21(19)22)26(32)20-12-17(2)23(29)13-24(20)30/h3-13,29-30H,1,14-16H2,2H3 |
| InChIKey | LYQINARSUQMLLW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|