C26H33N3O3 — CID 172614199
(E)-N-[2-(3-tert-butyl-4-hydroxybenzoyl)-1,3-dihydroisoindol-4-yl]-4-(dimethylamino)-N-methylbut-2-enamide (PubChem CID 172614199) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is (E)-N-[2-(3-tert-butyl-4-hydroxybenzoyl)-1,3-dihydroisoindol-4-yl]-4-(dimethylamino)-N-methylbut-2-enamide.
| Compound Name | (E)-N-[2-(3-tert-butyl-4-hydroxybenzoyl)-1,3-dihydroisoindol-4-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 172614199 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | (E)-N-[2-(3-tert-butyl-4-hydroxybenzoyl)-1,3-dihydroisoindol-4-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)N(C)c1cccc2c1CN(C(=O)c1ccc(O)c(C(C)(C)C)c1)C2 |
| InChI | InChI=1S/C26H33N3O3/c1-26(2,3)21-15-18(12-13-23(21)30)25(32)29-16-19-9-7-10-22(20(19)17-29)28(6)24(31)11-8-14-27(4)5/h7-13,15,30H,14,16-17H2,1-6H3/b11-8+ |
| InChIKey | MCEWYVNGTMRZPY-DHZHZOJOSA-N |
| XLogP | 3.93 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|