About (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite
(1-methyl-6-oxopyridazin-4-yl) thiohypochlorite (PubChem CID 172614352) has the molecular formula C5H5ClN2OS
and a molecular weight of 176.63 g/mol. Its IUPAC name is (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite.
Molecular Properties
| Compound Name | (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite |
| PubChem CID | 172614352 |
| Molecular Formula | C5H5ClN2OS |
| Molecular Weight | 176.63 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite |
| SMILES | Cn1ncc(SCl)cc1=O |
| InChI | InChI=1S/C5H5ClN2OS/c1-8-5(9)2-4(10-6)3-7-8/h2-3H,1H3 |
| InChIKey | RPMYVMVVGSXSJM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.63 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite?
The IUPAC name of (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite (CID 172614352) is (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite.
What is the SMILES notation for (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite?
The canonical SMILES for (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite is Cn1ncc(SCl)cc1=O.
What is the InChIKey of (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite?
The InChIKey is RPMYVMVVGSXSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2OS/c1-8-5(9)2-4(10-6)3-7-8/h2-3H,1H3.
What are the key properties of (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite?
(1-methyl-6-oxopyridazin-4-yl) thiohypochlorite has a molecular weight of 176.63 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-6-oxopyridazin-4-yl) thiohypochlorite is sourced from PubChem (CID 172614352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).