C17H26N2O2S — CID 172614423
ethane;4-[(4-methoxyphenyl)methylsulfanyl]-1H-pyridazin-6-one;propane (PubChem CID 172614423) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is ethane;4-[(4-methoxyphenyl)methylsulfanyl]-1H-pyridazin-6-one;propane.
| Compound Name | ethane;4-[(4-methoxyphenyl)methylsulfanyl]-1H-pyridazin-6-one;propane |
|---|---|
| PubChem CID | 172614423 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | ethane;4-[(4-methoxyphenyl)methylsulfanyl]-1H-pyridazin-6-one;propane |
| SMILES | CC.CCC.COc1ccc(CSc2cn[nH]c(=O)c2)cc1 |
| InChI | InChI=1S/C12H12N2O2S.C3H8.C2H6/c1-16-10-4-2-9(3-5-10)8-17-11-6-12(15)14-13-7-11;1-3-2;1-2/h2-7H,8H2,1H3,(H,14,15);3H2,1-2H3;1-2H3 |
| InChIKey | DPWUMWYCKRDTGY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |