C18H18ClF3N2OS — CID 172614565
7-[[(1R)-1-(4-chlorophenyl)-2,2,2-trifluoroethyl]-ethylamino]sulfanyl-2,3-dihydro-1H-indolizin-5-one (PubChem CID 172614565) has the molecular formula C18H18ClF3N2OS and a molecular weight of 402.87 g/mol. Its IUPAC name is 7-[[(1R)-1-(4-chlorophenyl)-2,2,2-trifluoroethyl]-ethylamino]sulfanyl-2,3-dihydro-1H-indolizin-5-one.
| Compound Name | 7-[[(1R)-1-(4-chlorophenyl)-2,2,2-trifluoroethyl]-ethylamino]sulfanyl-2,3-dihydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 172614565 |
| Molecular Formula | C18H18ClF3N2OS |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 7-[[(1R)-1-(4-chlorophenyl)-2,2,2-trifluoroethyl]-ethylamino]sulfanyl-2,3-dihydro-1H-indolizin-5-one |
| SMILES | CCN(Sc1cc2n(c(=O)c1)CCC2)[C@H](c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H18ClF3N2OS/c1-2-24(17(18(20,21)22)12-5-7-13(19)8-6-12)26-15-10-14-4-3-9-23(14)16(25)11-15/h5-8,10-11,17H,2-4,9H2,1H3/t17-/m1/s1 |
| InChIKey | ZAPBRMPTZCLRCK-QGZVFWFLSA-N |
| XLogP | 5.08 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|