C17H20ClF3N2O2S — CID 172614733
(1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;1-(2-methoxyethyl)-5-sulfanylpyridin-2-one (PubChem CID 172614733) has the molecular formula C17H20ClF3N2O2S and a molecular weight of 408.87 g/mol. Its IUPAC name is (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;1-(2-methoxyethyl)-5-sulfanylpyridin-2-one.
| Compound Name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;1-(2-methoxyethyl)-5-sulfanylpyridin-2-one |
|---|---|
| PubChem CID | 172614733 |
| Molecular Formula | C17H20ClF3N2O2S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine;1-(2-methoxyethyl)-5-sulfanylpyridin-2-one |
| SMILES | CN[C@H](c1ccc(Cl)cc1)C(F)(F)F.COCCn1cc(S)ccc1=O |
| InChI | InChI=1S/C9H9ClF3N.C8H11NO2S/c1-14-8(9(11,12)13)6-2-4-7(10)5-3-6;1-11-5-4-9-6-7(12)2-3-8(9)10/h2-5,8,14H,1H3;2-3,6,12H,4-5H2,1H3/t8-;/m1./s1 |
| InChIKey | ZFGYODBSWMDZCT-DDWIOCJRSA-N |
| XLogP | 3.95 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|