C12H23N3O — CID 172614898
ethane;3H-[1,2,4]triazolo[1,5-a]pyridin-5-one (PubChem CID 172614898) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is ethane;3H-[1,2,4]triazolo[1,5-a]pyridin-5-one.
| Compound Name | ethane;3H-[1,2,4]triazolo[1,5-a]pyridin-5-one |
|---|---|
| PubChem CID | 172614898 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | ethane;3H-[1,2,4]triazolo[1,5-a]pyridin-5-one |
| SMILES | CC.CC.CC.O=c1cccc2nc[nH]n12 |
| InChI | InChI=1S/C6H5N3O.3C2H6/c10-6-3-1-2-5-7-4-8-9(5)6;3*1-2/h1-4H,(H,7,8);3*1-2H3 |
| InChIKey | MNZHBFORGAXOPC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |