C16H22ClF3N2OS — CID 172614923
1-(4-chlorophenyl)-N-(2,2-dimethylmorpholin-4-yl)sulfanyl-N-ethyl-2,2,2-trifluoroethanamine (PubChem CID 172614923) has the molecular formula C16H22ClF3N2OS and a molecular weight of 382.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(2,2-dimethylmorpholin-4-yl)sulfanyl-N-ethyl-2,2,2-trifluoroethanamine.
| Compound Name | 1-(4-chlorophenyl)-N-(2,2-dimethylmorpholin-4-yl)sulfanyl-N-ethyl-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 172614923 |
| Molecular Formula | C16H22ClF3N2OS |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(2,2-dimethylmorpholin-4-yl)sulfanyl-N-ethyl-2,2,2-trifluoroethanamine |
| SMILES | CCN(SN1CCOC(C)(C)C1)C(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H22ClF3N2OS/c1-4-22(24-21-9-10-23-15(2,3)11-21)14(16(18,19)20)12-5-7-13(17)8-6-12/h5-8,14H,4,9-11H2,1-3H3 |
| InChIKey | MBYSRBDIFLVLSA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|