C14H18ClF3N2OS — CID 172615038
(1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methyl-N-[(3S)-3-methylmorpholin-4-yl]sulfanylethanamine (PubChem CID 172615038) has the molecular formula C14H18ClF3N2OS and a molecular weight of 354.83 g/mol. Its IUPAC name is (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methyl-N-[(3S)-3-methylmorpholin-4-yl]sulfanylethanamine.
| Compound Name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methyl-N-[(3S)-3-methylmorpholin-4-yl]sulfanylethanamine |
|---|---|
| PubChem CID | 172615038 |
| Molecular Formula | C14H18ClF3N2OS |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methyl-N-[(3S)-3-methylmorpholin-4-yl]sulfanylethanamine |
| SMILES | C[C@H]1COCCN1SN(C)[C@H](c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H18ClF3N2OS/c1-10-9-21-8-7-20(10)22-19(2)13(14(16,17)18)11-3-5-12(15)6-4-11/h3-6,10,13H,7-9H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | PWJKRDYGRAZVRQ-GXFFZTMASA-N |
| XLogP | 4.16 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|