C20H30N6O2Si — CID 172615839
N-[4,5-dimethyl-2-(2-trimethylsilylethoxymethyl)-4H-triazolo[4,5-c][1,7]naphthyridin-6-yl]cyclopropanecarboxamide (PubChem CID 172615839) has the molecular formula C20H30N6O2Si and a molecular weight of 414.59 g/mol. Its IUPAC name is N-[4,5-dimethyl-2-(2-trimethylsilylethoxymethyl)-4H-triazolo[4,5-c][1,7]naphthyridin-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[4,5-dimethyl-2-(2-trimethylsilylethoxymethyl)-4H-triazolo[4,5-c][1,7]naphthyridin-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 172615839 |
| Molecular Formula | C20H30N6O2Si |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-[4,5-dimethyl-2-(2-trimethylsilylethoxymethyl)-4H-triazolo[4,5-c][1,7]naphthyridin-6-yl]cyclopropanecarboxamide |
| SMILES | CC1c2nn(COCC[Si](C)(C)C)nc2-c2ccnc(NC(=O)C3CC3)c2N1C |
| InChI | InChI=1S/C20H30N6O2Si/c1-13-16-17(24-26(23-16)12-28-10-11-29(3,4)5)15-8-9-21-19(18(15)25(13)2)22-20(27)14-6-7-14/h8-9,13-14H,6-7,10-12H2,1-5H3,(H,21,22,27) |
| InChIKey | ZQVVELZIDPUUKC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|