About N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane
N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane (PubChem CID 172616626) has the molecular formula C19H25N
and a molecular weight of 267.42 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane |
| PubChem CID | 172616626 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane |
| SMILES | C#Cc1ccc(C)cc1.C=NC1=CCCC=C1.CCC |
| InChI | InChI=1S/C9H8.C7H9N.C3H8/c1-3-9-6-4-8(2)5-7-9;1-8-7-5-3-2-4-6-7;1-3-2/h1,4-7H,2H3;3,5-6H,1-2,4H2;3H2,1-2H3 |
| InChIKey | AISYBCQLXSTUPO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane?
The IUPAC name of N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane (CID 172616626) is N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane?
The canonical SMILES for N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane is C#Cc1ccc(C)cc1.C=NC1=CCCC=C1.CCC.
What is the InChIKey of N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane?
The InChIKey is AISYBCQLXSTUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C7H9N.C3H8/c1-3-9-6-4-8(2)5-7-9;1-8-7-5-3-2-4-6-7;1-3-2/h1,4-7H,2H3;3,5-6H,1-2,4H2;3H2,1-2H3.
What are the key properties of N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane?
N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane has a molecular weight of 267.42 g/mol, XLogP of 5.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-ylmethanimine;1-ethynyl-4-methylbenzene;propane is sourced from PubChem (CID 172616626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).