C13H11F — CID 172616698
1-fluoro-4-propan-2-yl-5,6-didehydronaphthalene (PubChem CID 172616698) has the molecular formula C13H11F and a molecular weight of 186.23 g/mol. Its IUPAC name is 1-fluoro-4-propan-2-yl-5,6-didehydronaphthalene.
| Compound Name | 1-fluoro-4-propan-2-yl-5,6-didehydronaphthalene |
|---|---|
| PubChem CID | 172616698 |
| Molecular Formula | C13H11F |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 1-fluoro-4-propan-2-yl-5,6-didehydronaphthalene |
| SMILES | CC(C)c1ccc(F)c2ccc#cc12 |
| InChI | InChI=1S/C13H11F/c1-9(2)10-7-8-13(14)12-6-4-3-5-11(10)12/h4,6-9H,1-2H3 |
| InChIKey | ZZWHEYWBKXACNA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |