C25H32N4O2 — CID 172616702
N-(1,6-dimethylbenzimidazol-2-yl)-6-[(3Z)-4-methoxy-2-methylhepta-1,3-dien-3-yl]-2-methyl-1,2-dihydropyridine-4-carboxamide (PubChem CID 172616702) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-(1,6-dimethylbenzimidazol-2-yl)-6-[(3Z)-4-methoxy-2-methylhepta-1,3-dien-3-yl]-2-methyl-1,2-dihydropyridine-4-carboxamide.
| Compound Name | N-(1,6-dimethylbenzimidazol-2-yl)-6-[(3Z)-4-methoxy-2-methylhepta-1,3-dien-3-yl]-2-methyl-1,2-dihydropyridine-4-carboxamide |
|---|---|
| PubChem CID | 172616702 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N-(1,6-dimethylbenzimidazol-2-yl)-6-[(3Z)-4-methoxy-2-methylhepta-1,3-dien-3-yl]-2-methyl-1,2-dihydropyridine-4-carboxamide |
| SMILES | C=C(C)/C(C1=CC(C(=O)Nc2nc3ccc(C)cc3n2C)=CC(C)N1)=C(\CCC)OC |
| InChI | InChI=1S/C25H32N4O2/c1-8-9-22(31-7)23(15(2)3)20-14-18(13-17(5)26-20)24(30)28-25-27-19-11-10-16(4)12-21(19)29(25)6/h10-14,17,26H,2,8-9H2,1,3-7H3,(H,27,28,30)/b23-22- |
| InChIKey | ZOSFKOYIOGVZMY-FCQUAONHSA-N |
| XLogP | 4.90 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|