C21H33NO — CID 172616944
5-[(3E,5Z)-6,7-dimethyl-4-prop-1-en-2-ylnona-1,3,5-trien-2-yl]-4-methoxy-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 172616944) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 5-[(3E,5Z)-6,7-dimethyl-4-prop-1-en-2-ylnona-1,3,5-trien-2-yl]-4-methoxy-1-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 5-[(3E,5Z)-6,7-dimethyl-4-prop-1-en-2-ylnona-1,3,5-trien-2-yl]-4-methoxy-1-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 172616944 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 5-[(3E,5Z)-6,7-dimethyl-4-prop-1-en-2-ylnona-1,3,5-trien-2-yl]-4-methoxy-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | C=C(/C=C(\C=C(\C)C(C)CC)C(=C)C)C1=C(OC)CCN(C)C1 |
| InChI | InChI=1S/C21H33NO/c1-9-16(4)17(5)12-19(15(2)3)13-18(6)20-14-22(7)11-10-21(20)23-8/h12-13,16H,2,6,9-11,14H2,1,3-5,7-8H3/b17-12-,19-13+ |
| InChIKey | IAFRCASQKJDMSZ-YLRSGACBSA-N |
| XLogP | 5.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|