About 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one
5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one (PubChem CID 172617440) has the molecular formula C24H38FNO3
and a molecular weight of 407.57 g/mol. Its IUPAC name is 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one.
Molecular Properties
| Compound Name | 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one |
| PubChem CID | 172617440 |
| Molecular Formula | C24H38FNO3 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one |
| SMILES | CCC(=O)C(CCC(C)=O)Nc1ccc(C)c(F)c1.CCCC(=O)CCC(C)C |
| InChI | InChI=1S/C15H20FNO2.C9H18O/c1-4-15(19)14(8-6-11(3)18)17-12-7-5-10(2)13(16)9-12;1-4-5-9(10)7-6-8(2)3/h5,7,9,14,17H,4,6,8H2,1-3H3;8H,4-7H2,1-3H3 |
| InChIKey | KDFGYFDGVVCHNE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one?
The IUPAC name of 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one (CID 172617440) is 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one.
What is the SMILES notation for 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one?
The canonical SMILES for 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one is CCC(=O)C(CCC(C)=O)Nc1ccc(C)c(F)c1.CCCC(=O)CCC(C)C.
What is the InChIKey of 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one?
The InChIKey is KDFGYFDGVVCHNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO2.C9H18O/c1-4-15(19)14(8-6-11(3)18)17-12-7-5-10(2)13(16)9-12;1-4-5-9(10)7-6-8(2)3/h5,7,9,14,17H,4,6,8H2,1-3H3;8H,4-7H2,1-3H3.
What are the key properties of 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one?
5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one has a molecular weight of 407.57 g/mol, XLogP of 6.05, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluoro-4-methylanilino)octane-2,6-dione;7-methyloctan-4-one is sourced from PubChem (CID 172617440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).