C24H32N2O3 — CID 172618399
(1R,2S,6S)-2-[hydroxy-(4-propan-2-ylanilino)methyl]-6-[4-(methylamino)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 172618399) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is (1R,2S,6S)-2-[hydroxy-(4-propan-2-ylanilino)methyl]-6-[4-(methylamino)phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | (1R,2S,6S)-2-[hydroxy-(4-propan-2-ylanilino)methyl]-6-[4-(methylamino)phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 172618399 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | (1R,2S,6S)-2-[hydroxy-(4-propan-2-ylanilino)methyl]-6-[4-(methylamino)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | CNc1ccc([C@H]2CCC[C@H](C(O)Nc3ccc(C(C)C)cc3)[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C24H32N2O3/c1-15(2)16-7-13-19(14-8-16)26-23(27)21-6-4-5-20(22(21)24(28)29)17-9-11-18(25-3)12-10-17/h7-15,20-23,25-27H,4-6H2,1-3H3,(H,28,29)/t20-,21+,22-,23?/m1/s1 |
| InChIKey | NKBMSSQAVDLOJP-VNYJYPEVSA-N |
| XLogP | 4.87 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|