C32H40N4O3S — CID 172618436
3-[4-(1,2-dimethylbenzimidazol-5-yl)phenyl]-N-(4-ethylphenyl)cyclohexane-1-carboxamide;formic acid;N-methylthiohydroxylamine (PubChem CID 172618436) has the molecular formula C32H40N4O3S and a molecular weight of 560.76 g/mol. Its IUPAC name is 3-[4-(1,2-dimethylbenzimidazol-5-yl)phenyl]-N-(4-ethylphenyl)cyclohexane-1-carboxamide;formic acid;N-methylthiohydroxylamine.
| Compound Name | 3-[4-(1,2-dimethylbenzimidazol-5-yl)phenyl]-N-(4-ethylphenyl)cyclohexane-1-carboxamide;formic acid;N-methylthiohydroxylamine |
|---|---|
| PubChem CID | 172618436 |
| Molecular Formula | C32H40N4O3S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 3-[4-(1,2-dimethylbenzimidazol-5-yl)phenyl]-N-(4-ethylphenyl)cyclohexane-1-carboxamide;formic acid;N-methylthiohydroxylamine |
| SMILES | CCc1ccc(NC(=O)C2CCCC(c3ccc(-c4ccc5c(c4)nc(C)n5C)cc3)C2)cc1.CNS.O=CO |
| InChI | InChI=1S/C30H33N3O.CH5NS.CH2O2/c1-4-21-8-15-27(16-9-21)32-30(34)26-7-5-6-24(18-26)22-10-12-23(13-11-22)25-14-17-29-28(19-25)31-20(2)33(29)3;1-2-3;2-1-3/h8-17,19,24,26H,4-7,18H2,1-3H3,(H,32,34);2-3H,1H3;1H,(H,2,3) |
| InChIKey | ONVAUSDXRQHGCS-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|