C21H28ClN3O2 — CID 172619064
N-(2-morpholin-4-ylphenyl)-5-pentylpyridine-2-carboxamide;hydrochloride (PubChem CID 172619064) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is N-(2-morpholin-4-ylphenyl)-5-pentylpyridine-2-carboxamide;hydrochloride.
| Compound Name | N-(2-morpholin-4-ylphenyl)-5-pentylpyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172619064 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-(2-morpholin-4-ylphenyl)-5-pentylpyridine-2-carboxamide;hydrochloride |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccccc2N2CCOCC2)nc1.Cl |
| InChI | InChI=1S/C21H27N3O2.ClH/c1-2-3-4-7-17-10-11-19(22-16-17)21(25)23-18-8-5-6-9-20(18)24-12-14-26-15-13-24;/h5-6,8-11,16H,2-4,7,12-15H2,1H3,(H,23,25);1H |
| InChIKey | IRBUBZLNTJZONJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|