About 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine
5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine (PubChem CID 172619623) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 172619623 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine |
| SMILES | CNc1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C10H12N4/c1-11-10-12-9(13-14-10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,11,12,13,14) |
| InChIKey | JZBZAYVZLHIXBY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine (CID 172619623) is 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine is CNc1n[nH]c(Cc2ccccc2)n1.
What is the InChIKey of 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine?
The InChIKey is JZBZAYVZLHIXBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-11-10-12-9(13-14-10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,11,12,13,14).
What are the key properties of 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine?
5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine has a molecular weight of 188.23 g/mol, XLogP of 1.44, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-N-methyl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 172619623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).