About methanol;(1-propylpyrrolidin-3-yl)methanol
methanol;(1-propylpyrrolidin-3-yl)methanol (PubChem CID 172620520) has the molecular formula C9H21NO2
and a molecular weight of 175.27 g/mol. Its IUPAC name is methanol;(1-propylpyrrolidin-3-yl)methanol.
Molecular Properties
| Compound Name | methanol;(1-propylpyrrolidin-3-yl)methanol |
| PubChem CID | 172620520 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | methanol;(1-propylpyrrolidin-3-yl)methanol |
| SMILES | CCCN1CCC(CO)C1.CO |
| InChI | InChI=1S/C8H17NO.CH4O/c1-2-4-9-5-3-8(6-9)7-10;1-2/h8,10H,2-7H2,1H3;2H,1H3 |
| InChIKey | GHEUCMBDGHRGRJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanol;(1-propylpyrrolidin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;(1-propylpyrrolidin-3-yl)methanol?
The IUPAC name of methanol;(1-propylpyrrolidin-3-yl)methanol (CID 172620520) is methanol;(1-propylpyrrolidin-3-yl)methanol.
What is the SMILES notation for methanol;(1-propylpyrrolidin-3-yl)methanol?
The canonical SMILES for methanol;(1-propylpyrrolidin-3-yl)methanol is CCCN1CCC(CO)C1.CO.
What is the InChIKey of methanol;(1-propylpyrrolidin-3-yl)methanol?
The InChIKey is GHEUCMBDGHRGRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.CH4O/c1-2-4-9-5-3-8(6-9)7-10;1-2/h8,10H,2-7H2,1H3;2H,1H3.
What are the key properties of methanol;(1-propylpyrrolidin-3-yl)methanol?
methanol;(1-propylpyrrolidin-3-yl)methanol has a molecular weight of 175.27 g/mol, XLogP of 0.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;(1-propylpyrrolidin-3-yl)methanol is sourced from PubChem (CID 172620520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).