C14H20ClNOY — CID 172620619
[1-[2-(3-chlorophenyl)ethyl]-5-methylpyrrolidin-3-yl]methanol;yttrium (PubChem CID 172620619) has the molecular formula C14H20ClNOY and a molecular weight of 342.68 g/mol. Its IUPAC name is [1-[2-(3-chlorophenyl)ethyl]-5-methylpyrrolidin-3-yl]methanol;yttrium.
| Compound Name | [1-[2-(3-chlorophenyl)ethyl]-5-methylpyrrolidin-3-yl]methanol;yttrium |
|---|---|
| PubChem CID | 172620619 |
| Molecular Formula | C14H20ClNOY |
| Molecular Weight | 342.68 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | [1-[2-(3-chlorophenyl)ethyl]-5-methylpyrrolidin-3-yl]methanol;yttrium |
| SMILES | CC1CC(CO)CN1CCc1cccc(Cl)c1.[Y] |
| InChI | InChI=1S/C14H20ClNO.Y/c1-11-7-13(10-17)9-16(11)6-5-12-3-2-4-14(15)8-12;/h2-4,8,11,13,17H,5-7,9-10H2,1H3; |
| InChIKey | GJIOEGZDZAKIIS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |