C20H15Cl3FN5S — CID 172620869
5-[3-[[2,5-dichloro-3-(chloromethyl)phenyl]sulfanylamino]-2-fluorophenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 172620869) has the molecular formula C20H15Cl3FN5S and a molecular weight of 482.80 g/mol. Its IUPAC name is 5-[3-[[2,5-dichloro-3-(chloromethyl)phenyl]sulfanylamino]-2-fluorophenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-[3-[[2,5-dichloro-3-(chloromethyl)phenyl]sulfanylamino]-2-fluorophenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172620869 |
| Molecular Formula | C20H15Cl3FN5S |
| Molecular Weight | 482.80 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 5-[3-[[2,5-dichloro-3-(chloromethyl)phenyl]sulfanylamino]-2-fluorophenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cn1cc(-c2cccc(NSc3cc(Cl)cc(CCl)c3Cl)c2F)c2c(N)ncnc21 |
| InChI | InChI=1S/C20H15Cl3FN5S/c1-29-8-13(16-19(25)26-9-27-20(16)29)12-3-2-4-14(18(12)24)28-30-15-6-11(22)5-10(7-21)17(15)23/h2-6,8-9,28H,7H2,1H3,(H2,25,26,27) |
| InChIKey | FDUCOOKNAIJXIG-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.80 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|