C20H16F3N5OS — CID 172620932
[3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-2,5-difluorophenyl]methanol (PubChem CID 172620932) has the molecular formula C20H16F3N5OS and a molecular weight of 431.44 g/mol. Its IUPAC name is [3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-2,5-difluorophenyl]methanol.
| Compound Name | [3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-2,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 172620932 |
| Molecular Formula | C20H16F3N5OS |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [3-[3-(8-amino-3-methylimidazo[1,5-a]pyrazin-1-yl)-2-fluoroanilino]sulfanyl-2,5-difluorophenyl]methanol |
| SMILES | Cc1nc(-c2cccc(NSc3cc(F)cc(CO)c3F)c2F)c2c(N)nccn12 |
| InChI | InChI=1S/C20H16F3N5OS/c1-10-26-18(19-20(24)25-5-6-28(10)19)13-3-2-4-14(17(13)23)27-30-15-8-12(21)7-11(9-29)16(15)22/h2-8,27,29H,9H2,1H3,(H2,24,25) |
| InChIKey | SKJDGUAYWKGFAF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|