About 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate
7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate (PubChem CID 172621078) has the molecular formula C20H29BrO4
and a molecular weight of 413.35 g/mol. Its IUPAC name is 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate.
Molecular Properties
| Compound Name | 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate |
| PubChem CID | 172621078 |
| Molecular Formula | C20H29BrO4 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate |
| SMILES | CC.COC(=O)C=C(C)C.Cc1cc(Br)cc2c1C(C)(C)CC(=O)O2 |
| InChI | InChI=1S/C12H13BrO2.C6H10O2.C2H6/c1-7-4-8(13)5-9-11(7)12(2,3)6-10(14)15-9;1-5(2)4-6(7)8-3;1-2/h4-5H,6H2,1-3H3;4H,1-3H3;1-2H3 |
| InChIKey | BVKPCZZSLKNAJI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate?
The IUPAC name of 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate (CID 172621078) is 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate.
What is the SMILES notation for 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate?
The canonical SMILES for 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate is CC.COC(=O)C=C(C)C.Cc1cc(Br)cc2c1C(C)(C)CC(=O)O2.
What is the InChIKey of 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate?
The InChIKey is BVKPCZZSLKNAJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO2.C6H10O2.C2H6/c1-7-4-8(13)5-9-11(7)12(2,3)6-10(14)15-9;1-5(2)4-6(7)8-3;1-2/h4-5H,6H2,1-3H3;4H,1-3H3;1-2H3.
What are the key properties of 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate?
7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate has a molecular weight of 413.35 g/mol, XLogP of 5.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate is sourced from PubChem (CID 172621078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).