C20H29BrO4 — CID 172621078
7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate (PubChem CID 172621078) has the molecular formula C20H29BrO4 and a molecular weight of 413.35 g/mol. Its IUPAC name is 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate.
| Compound Name | 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 172621078 |
| Molecular Formula | C20H29BrO4 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 7-bromo-4,4,5-trimethyl-3H-chromen-2-one;ethane;methyl 3-methylbut-2-enoate |
| SMILES | CC.COC(=O)C=C(C)C.Cc1cc(Br)cc2c1C(C)(C)CC(=O)O2 |
| InChI | InChI=1S/C12H13BrO2.C6H10O2.C2H6/c1-7-4-8(13)5-9-11(7)12(2,3)6-10(14)15-9;1-5(2)4-6(7)8-3;1-2/h4-5H,6H2,1-3H3;4H,1-3H3;1-2H3 |
| InChIKey | BVKPCZZSLKNAJI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|