C25H18BrClF2N4O — CID 172621887
7-bromo-N-(3-chloro-2,4-difluorophenyl)-5-[1-(1-methylindol-2-yl)ethoxy]quinazolin-4-amine (PubChem CID 172621887) has the molecular formula C25H18BrClF2N4O and a molecular weight of 543.80 g/mol. Its IUPAC name is 7-bromo-N-(3-chloro-2,4-difluorophenyl)-5-[1-(1-methylindol-2-yl)ethoxy]quinazolin-4-amine.
| Compound Name | 7-bromo-N-(3-chloro-2,4-difluorophenyl)-5-[1-(1-methylindol-2-yl)ethoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 172621887 |
| Molecular Formula | C25H18BrClF2N4O |
| Molecular Weight | 543.80 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | 7-bromo-N-(3-chloro-2,4-difluorophenyl)-5-[1-(1-methylindol-2-yl)ethoxy]quinazolin-4-amine |
| SMILES | CC(Oc1cc(Br)cc2ncnc(Nc3ccc(F)c(Cl)c3F)c12)c1cc2ccccc2n1C |
| InChI | InChI=1S/C25H18BrClF2N4O/c1-13(20-9-14-5-3-4-6-19(14)33(20)2)34-21-11-15(26)10-18-22(21)25(31-12-30-18)32-17-8-7-16(28)23(27)24(17)29/h3-13H,1-2H3,(H,30,31,32) |
| InChIKey | GGLJBIVEPWGSJP-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.80 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|