About 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline
3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline (PubChem CID 172622042) has the molecular formula C12H21NO4S
and a molecular weight of 275.37 g/mol. Its IUPAC name is 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline.
Molecular Properties
| Compound Name | 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline |
| PubChem CID | 172622042 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline |
| SMILES | COS(CCCOc1cccc(N)c1)(OC)OC |
| InChI | InChI=1S/C12H21NO4S/c1-14-18(15-2,16-3)9-5-8-17-12-7-4-6-11(13)10-12/h4,6-7,10H,5,8-9,13H2,1-3H3 |
| InChIKey | DBWSKJZPKRXWIZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline?
The IUPAC name of 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline (CID 172622042) is 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline.
What is the SMILES notation for 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline?
The canonical SMILES for 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline is COS(CCCOc1cccc(N)c1)(OC)OC.
What is the InChIKey of 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline?
The InChIKey is DBWSKJZPKRXWIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4S/c1-14-18(15-2,16-3)9-5-8-17-12-7-4-6-11(13)10-12/h4,6-7,10H,5,8-9,13H2,1-3H3.
What are the key properties of 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline?
3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline has a molecular weight of 275.37 g/mol, XLogP of 2.53, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(trimethoxy-λ4-sulfanyl)propoxy]aniline is sourced from PubChem (CID 172622042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).