C19H17N5O — CID 172622058
4-amino-3-(3-methoxy-2,6-dimethylphenyl)-1,3,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-5-carbonitrile (PubChem CID 172622058) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-amino-3-(3-methoxy-2,6-dimethylphenyl)-1,3,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-5-carbonitrile.
| Compound Name | 4-amino-3-(3-methoxy-2,6-dimethylphenyl)-1,3,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-5-carbonitrile |
|---|---|
| PubChem CID | 172622058 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-amino-3-(3-methoxy-2,6-dimethylphenyl)-1,3,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-5-carbonitrile |
| SMILES | COc1ccc(C)c(-n2c(N)c(C#N)c3ccc4ccnn4c32)c1C |
| InChI | InChI=1S/C19H17N5O/c1-11-4-7-16(25-3)12(2)17(11)23-18(21)15(10-20)14-6-5-13-8-9-22-24(13)19(14)23/h4-9H,21H2,1-3H3 |
| InChIKey | NPTDZQNVCDAANJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |