C19H20N6O2 — CID 172622240
11-amino-12-(3-methoxy-2,6-dimethylphenyl)-7-methyl-3,5,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene-10-carboxamide (PubChem CID 172622240) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 11-amino-12-(3-methoxy-2,6-dimethylphenyl)-7-methyl-3,5,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene-10-carboxamide.
| Compound Name | 11-amino-12-(3-methoxy-2,6-dimethylphenyl)-7-methyl-3,5,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene-10-carboxamide |
|---|---|
| PubChem CID | 172622240 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 11-amino-12-(3-methoxy-2,6-dimethylphenyl)-7-methyl-3,5,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene-10-carboxamide |
| SMILES | COc1ccc(C)c(-c2c(N)c(C(N)=O)n3cc(C)n4ncnc4c23)c1C |
| InChI | InChI=1S/C19H20N6O2/c1-9-5-6-12(27-4)11(3)13(9)14-15(20)17(18(21)26)24-7-10(2)25-19(16(14)24)22-8-23-25/h5-8H,20H2,1-4H3,(H2,21,26) |
| InChIKey | MXMFNAOKGBUFHI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |