About 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine
8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 172622293) has the molecular formula C6H5BrN4
and a molecular weight of 213.04 g/mol. Its IUPAC name is 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine.
Molecular Properties
| Compound Name | 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine |
| PubChem CID | 172622293 |
| Molecular Formula | C6H5BrN4 |
| Molecular Weight | 213.04 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | Cc1ncn2cnnc2c1Br |
| InChI | InChI=1S/C6H5BrN4/c1-4-5(7)6-10-9-3-11(6)2-8-4/h2-3H,1H3 |
| InChIKey | XSLUZTZPFSOCCM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.04 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine?
The IUPAC name of 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine (CID 172622293) is 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine.
What is the SMILES notation for 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine?
The canonical SMILES for 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine is Cc1ncn2cnnc2c1Br.
What is the InChIKey of 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine?
The InChIKey is XSLUZTZPFSOCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN4/c1-4-5(7)6-10-9-3-11(6)2-8-4/h2-3H,1H3.
What are the key properties of 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine?
8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine has a molecular weight of 213.04 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-7-methyl-[1,2,4]triazolo[4,3-c]pyrimidine is sourced from PubChem (CID 172622293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).