C17H15ClN6O2 — CID 172622342
11-amino-12-(6-chloro-3-hydroxy-2-methylphenyl)-7-methyl-3,5,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaene-10-carboxamide (PubChem CID 172622342) has the molecular formula C17H15ClN6O2 and a molecular weight of 370.80 g/mol. Its IUPAC name is 11-amino-12-(6-chloro-3-hydroxy-2-methylphenyl)-7-methyl-3,5,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaene-10-carboxamide.
| Compound Name | 11-amino-12-(6-chloro-3-hydroxy-2-methylphenyl)-7-methyl-3,5,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaene-10-carboxamide |
|---|---|
| PubChem CID | 172622342 |
| Molecular Formula | C17H15ClN6O2 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 11-amino-12-(6-chloro-3-hydroxy-2-methylphenyl)-7-methyl-3,5,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaene-10-carboxamide |
| SMILES | Cc1c(O)ccc(Cl)c1-n1c(N)c(C(N)=O)c2cc(C)n3ncnc3c21 |
| InChI | InChI=1S/C17H15ClN6O2/c1-7-5-9-12(16(20)26)15(19)23(14(9)17-21-6-22-24(7)17)13-8(2)11(25)4-3-10(13)18/h3-6,25H,19H2,1-2H3,(H2,20,26) |
| InChIKey | XCZRIGMZRFTQSA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |