About ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine
ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine (PubChem CID 172622553) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine |
| PubChem CID | 172622553 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine |
| SMILES | CCN.[H]/N=C1\C=CC(N)=CC1=C |
| InChI | InChI=1S/C7H8N2.C2H7N/c1-5-4-6(8)2-3-7(5)9;1-2-3/h2-4,9H,1,8H2;2-3H2,1H3/b9-7+; |
| InChIKey | AHYUIMDBSGOZMZ-BXTVWIJMSA-N |
| XLogP | 0.94 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine?
The IUPAC name of ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine (CID 172622553) is ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine.
What is the SMILES notation for ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine?
The canonical SMILES for ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine is CCN.[H]/N=C1\C=CC(N)=CC1=C.
What is the InChIKey of ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine?
The InChIKey is AHYUIMDBSGOZMZ-BXTVWIJMSA-N. The full InChI is InChI=1S/C7H8N2.C2H7N/c1-5-4-6(8)2-3-7(5)9;1-2-3/h2-4,9H,1,8H2;2-3H2,1H3/b9-7+;.
What are the key properties of ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine?
ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine has a molecular weight of 165.24 g/mol, XLogP of 0.94, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;4-imino-3-methylidenecyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 172622553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).