C25H26N4O — CID 172623284
9-methyl-N-[[3-(methylamino)isoquinolin-7-yl]methyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 172623284) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 9-methyl-N-[[3-(methylamino)isoquinolin-7-yl]methyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 9-methyl-N-[[3-(methylamino)isoquinolin-7-yl]methyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 172623284 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 9-methyl-N-[[3-(methylamino)isoquinolin-7-yl]methyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CNc1cc2ccc(CNC(=O)c3ccc4c(c3)c3c(n4C)CCCC3)cc2cn1 |
| InChI | InChI=1S/C25H26N4O/c1-26-24-13-17-8-7-16(11-19(17)15-27-24)14-28-25(30)18-9-10-23-21(12-18)20-5-3-4-6-22(20)29(23)2/h7-13,15H,3-6,14H2,1-2H3,(H,26,27)(H,28,30) |
| InChIKey | UPPIOXGTCDZCKB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|